C21H22N2O5S — CID 50778699
N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-methoxybenzenesulfonamide (PubChem CID 50778699) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-methoxybenzenesulfonamide.
| Compound Name | N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 50778699 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-methoxybenzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)Nc2c(NC3CCCC3)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C21H22N2O5S/c1-27-15-9-6-10-16(13-15)29(25,26)23-20-19(22-14-7-2-3-8-14)17-11-4-5-12-18(17)28-21(20)24/h4-6,9-14,22-23H,2-3,7-8H2,1H3 |
| InChIKey | KTGAXYSJKNCWEY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|