C23H18N2O3 — CID 17251986
N-[4-(benzylamino)-2-oxochromen-3-yl]benzamide (PubChem CID 17251986) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[4-(benzylamino)-2-oxochromen-3-yl]benzamide.
| Compound Name | N-[4-(benzylamino)-2-oxochromen-3-yl]benzamide |
|---|---|
| PubChem CID | 17251986 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[4-(benzylamino)-2-oxochromen-3-yl]benzamide |
| SMILES | O=C(Nc1c(NCc2ccccc2)c2ccccc2oc1=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c26-22(17-11-5-2-6-12-17)25-21-20(24-15-16-9-3-1-4-10-16)18-13-7-8-14-19(18)28-23(21)27/h1-14,24H,15H2,(H,25,26) |
| InChIKey | FEMZLYWHKOXCSP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|