C22H22N2O4S — CID 46424949
ethyl 5-[3-[(2-phenylacetyl)amino]propanoylamino]-1-benzothiophene-2-carboxylate (PubChem CID 46424949) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is ethyl 5-[3-[(2-phenylacetyl)amino]propanoylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-[3-[(2-phenylacetyl)amino]propanoylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46424949 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | ethyl 5-[3-[(2-phenylacetyl)amino]propanoylamino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)CCNC(=O)Cc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C22H22N2O4S/c1-2-28-22(27)19-14-16-13-17(8-9-18(16)29-19)24-20(25)10-11-23-21(26)12-15-6-4-3-5-7-15/h3-9,13-14H,2,10-12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | LUTMSFYOUXPXLZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |