C15H18N2O4S — CID 51082080
ethyl 5-(1-hydroxypropan-2-ylcarbamoylamino)-1-benzothiophene-2-carboxylate (PubChem CID 51082080) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is ethyl 5-(1-hydroxypropan-2-ylcarbamoylamino)-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-(1-hydroxypropan-2-ylcarbamoylamino)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 51082080 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | ethyl 5-(1-hydroxypropan-2-ylcarbamoylamino)-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)NC(C)CO)ccc2s1 |
| InChI | InChI=1S/C15H18N2O4S/c1-3-21-14(19)13-7-10-6-11(4-5-12(10)22-13)17-15(20)16-9(2)8-18/h4-7,9,18H,3,8H2,1-2H3,(H2,16,17,20) |
| InChIKey | RVECSMIKFYPGBU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |