About ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate
ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate (PubChem CID 56788797) has the molecular formula C16H17N3O3S
and a molecular weight of 331.40 g/mol. Its IUPAC name is ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate |
| PubChem CID | 56788797 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(C)c3nnc(C)o3)ccc2s1 |
| InChI | InChI=1S/C16H17N3O3S/c1-4-21-16(20)14-8-11-7-12(5-6-13(11)23-14)17-9(2)15-19-18-10(3)22-15/h5-9,17H,4H2,1-3H3 |
| InChIKey | KWEQGEXVZFECGR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate?
The IUPAC name of ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate (CID 56788797) is ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate.
What is the SMILES notation for ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate?
The canonical SMILES for ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate is CCOC(=O)c1cc2cc(NC(C)c3nnc(C)o3)ccc2s1.
What is the InChIKey of ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate?
The InChIKey is KWEQGEXVZFECGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3S/c1-4-21-16(20)14-8-11-7-12(5-6-13(11)23-14)17-9(2)15-19-18-10(3)22-15/h5-9,17H,4H2,1-3H3.
What are the key properties of ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate?
ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate has a molecular weight of 331.40 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[1-(5-methyl-1,3,4-oxadiazol-2-yl)ethylamino]-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 56788797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).