C19H18N2O5S — CID 11855386
5-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide (PubChem CID 11855386) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide.
| Compound Name | 5-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11855386 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 5-[[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc3sc(C(=O)NO)cc3c2)cc1OC |
| InChI | InChI=1S/C19H18N2O5S/c1-25-14-5-3-11(7-15(14)26-2)8-18(22)20-13-4-6-16-12(9-13)10-17(27-16)19(23)21-24/h3-7,9-10,24H,8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | AHDVIKMUWBOHQU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|