C21H22N2O5S — CID 87619661
6-[[2-(3,4-diethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide (PubChem CID 87619661) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 6-[[2-(3,4-diethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide.
| Compound Name | 6-[[2-(3,4-diethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 87619661 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 6-[[2-(3,4-diethoxyphenyl)acetyl]amino]-N-hydroxy-1-benzothiophene-2-carboxamide |
| SMILES | CCOc1ccc(CC(=O)Nc2ccc3cc(C(=O)NO)sc3c2)cc1OCC |
| InChI | InChI=1S/C21H22N2O5S/c1-3-27-16-8-5-13(9-17(16)28-4-2)10-20(24)22-15-7-6-14-11-19(21(25)23-26)29-18(14)12-15/h5-9,11-12,26H,3-4,10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | ICNMSDQYZABNKT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|