C22H20N4OS — CID 68700472
N-(2-aminophenyl)-5-[(pyridin-2-ylmethylamino)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 68700472) has the molecular formula C22H20N4OS and a molecular weight of 388.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[(pyridin-2-ylmethylamino)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[(pyridin-2-ylmethylamino)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68700472 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(2-aminophenyl)-5-[(pyridin-2-ylmethylamino)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1cc2cc(CNCc3ccccn3)ccc2s1 |
| InChI | InChI=1S/C22H20N4OS/c23-18-6-1-2-7-19(18)26-22(27)21-12-16-11-15(8-9-20(16)28-21)13-24-14-17-5-3-4-10-25-17/h1-12,24H,13-14,23H2,(H,26,27) |
| InChIKey | MFCSEKMQXABDJB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|