C22H25N3O5S — CID 15951532
(2R)-2-amino-5-[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenoxy]pentanoic acid (PubChem CID 15951532) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is (2R)-2-amino-5-[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenoxy]pentanoic acid.
| Compound Name | (2R)-2-amino-5-[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 15951532 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (2R)-2-amino-5-[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenoxy]pentanoic acid |
| SMILES | N[C@H](CCCOc1ccc(CNCc2ccc3cc(C(=O)NO)sc3c2)cc1)C(=O)O |
| InChI | InChI=1S/C22H25N3O5S/c23-18(22(27)28)2-1-9-30-17-7-4-14(5-8-17)12-24-13-15-3-6-16-11-20(21(26)25-29)31-19(16)10-15/h3-8,10-11,18,24,29H,1-2,9,12-13,23H2,(H,25,26)(H,27,28)/t18-/m1/s1 |
| InChIKey | FHZLXCMJKSJSAS-GOSISDBHSA-N |
| XLogP | 2.88 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|