C9H8NO2PS — CID 143667764
N-hydroxy-6-phosphanyl-1-benzothiophene-2-carboxamide (PubChem CID 143667764) has the molecular formula C9H8NO2PS and a molecular weight of 225.21 g/mol. Its IUPAC name is N-hydroxy-6-phosphanyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-hydroxy-6-phosphanyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143667764 |
| Molecular Formula | C9H8NO2PS |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | N-hydroxy-6-phosphanyl-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NO)c1cc2ccc(P)cc2s1 |
| InChI | InChI=1S/C9H8NO2PS/c11-9(10-12)8-3-5-1-2-6(13)4-7(5)14-8/h1-4,12H,13H2,(H,10,11) |
| InChIKey | ULCMCWZQVGPSRJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|