C22H23NO — CID 135000197
(1R)-N-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylbut-3-en-1-amine (PubChem CID 135000197) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is (1R)-N-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylbut-3-en-1-amine.
| Compound Name | (1R)-N-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylbut-3-en-1-amine |
|---|---|
| PubChem CID | 135000197 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (1R)-N-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylbut-3-en-1-amine |
| SMILES | C=CC[C@@H](NCc1ccc(OC)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H23NO/c1-3-6-22(23-16-17-9-13-21(24-2)14-10-17)20-12-11-18-7-4-5-8-19(18)15-20/h3-5,7-15,22-23H,1,6,16H2,2H3/t22-/m1/s1 |
| InChIKey | YQBMZOOBGVRSEW-JOCHJYFZSA-N |
| XLogP | 5.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|