C28H29NO3 — CID 66807993
(1R)-1-amino-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylpropan-2-ol (PubChem CID 66807993) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is (1R)-1-amino-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylpropan-2-ol.
| Compound Name | (1R)-1-amino-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 66807993 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (1R)-1-amino-3-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-1-naphthalen-2-ylpropan-2-ol |
| SMILES | COc1ccc(CC(O)(Cc2ccc(OC)cc2)[C@H](N)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C28H29NO3/c1-31-25-13-7-20(8-14-25)18-28(30,19-21-9-15-26(32-2)16-10-21)27(29)24-12-11-22-5-3-4-6-23(22)17-24/h3-17,27,30H,18-19,29H2,1-2H3/t27-/m1/s1 |
| InChIKey | DDGZTQILVUHKSC-HHHXNRCGSA-N |
| XLogP | 5.07 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |