C20H20O3 — CID 100944960
2-(4-methoxyphenyl)-1-naphthalen-2-ylpropane-1,3-diol (PubChem CID 100944960) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-naphthalen-2-ylpropane-1,3-diol.
| Compound Name | 2-(4-methoxyphenyl)-1-naphthalen-2-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 100944960 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-naphthalen-2-ylpropane-1,3-diol |
| SMILES | COc1ccc(C(CO)C(O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C20H20O3/c1-23-18-10-8-15(9-11-18)19(13-21)20(22)17-7-6-14-4-2-3-5-16(14)12-17/h2-12,19-22H,13H2,1H3 |
| InChIKey | FVFUJAQALKPCDS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |