C20H25NO3 — CID 101268335
(1R)-N-benzyl-1-(3,4,5-trimethoxyphenyl)but-3-en-1-amine (PubChem CID 101268335) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (1R)-N-benzyl-1-(3,4,5-trimethoxyphenyl)but-3-en-1-amine.
| Compound Name | (1R)-N-benzyl-1-(3,4,5-trimethoxyphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 101268335 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (1R)-N-benzyl-1-(3,4,5-trimethoxyphenyl)but-3-en-1-amine |
| SMILES | C=CC[C@@H](NCc1ccccc1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25NO3/c1-5-9-17(21-14-15-10-7-6-8-11-15)16-12-18(22-2)20(24-4)19(13-16)23-3/h5-8,10-13,17,21H,1,9,14H2,2-4H3/t17-/m1/s1 |
| InChIKey | OORRILHNCIEDBA-QGZVFWFLSA-N |
| XLogP | 4.12 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|