C18H20N2O3 — CID 85390507
N-hydroxy-3-[4-[(2-phenoxyethylamino)methyl]phenyl]prop-2-enamide (PubChem CID 85390507) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-hydroxy-3-[4-[(2-phenoxyethylamino)methyl]phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[4-[(2-phenoxyethylamino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 85390507 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-hydroxy-3-[4-[(2-phenoxyethylamino)methyl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(CNCCOc2ccccc2)cc1)NO |
| InChI | InChI=1S/C18H20N2O3/c21-18(20-22)11-10-15-6-8-16(9-7-15)14-19-12-13-23-17-4-2-1-3-5-17/h1-11,19,22H,12-14H2,(H,20,21) |
| InChIKey | LTSQRCBVRANAJI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|