C22H24N2O6S — CID 91549188
cyclopentyl (2S)-2-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]-2-phenylacetate (PubChem CID 91549188) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 91549188 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | cyclopentyl (2S)-2-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]-2-phenylacetate |
| SMILES | O=C(C=Cc1cccc(S(=O)(=O)N[C@H](C(=O)OC2CCCC2)c2ccccc2)c1)NO |
| InChI | InChI=1S/C22H24N2O6S/c25-20(23-27)14-13-16-7-6-12-19(15-16)31(28,29)24-21(17-8-2-1-3-9-17)22(26)30-18-10-4-5-11-18/h1-3,6-9,12-15,18,21,24,27H,4-5,10-11H2,(H,23,25)/t21-/m0/s1 |
| InChIKey | LZVXNBNUEDKKHJ-NRFANRHFSA-N |
| XLogP | 2.71 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|