C15H13BrN2O4S — CID 91552459
3-[3-[bromo(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 91552459) has the molecular formula C15H13BrN2O4S and a molecular weight of 397.25 g/mol. Its IUPAC name is 3-[3-[bromo(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[3-[bromo(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 91552459 |
| Molecular Formula | C15H13BrN2O4S |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 3-[3-[bromo(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1cccc(S(=O)(=O)N(Br)c2ccccc2)c1)NO |
| InChI | InChI=1S/C15H13BrN2O4S/c16-18(13-6-2-1-3-7-13)23(21,22)14-8-4-5-12(11-14)9-10-15(19)17-20/h1-11,20H,(H,17,19) |
| InChIKey | VPHUNBBYXHUEFA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|