C21H20N2O4S — CID 88950309
(E)-3-[3-[cyclohexa-1,5-dien-1-yl(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 88950309) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is (E)-3-[3-[cyclohexa-1,5-dien-1-yl(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-[cyclohexa-1,5-dien-1-yl(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 88950309 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (E)-3-[3-[cyclohexa-1,5-dien-1-yl(phenyl)sulfamoyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(S(=O)(=O)N(C2=CCCC=C2)c2ccccc2)c1)NO |
| InChI | InChI=1S/C21H20N2O4S/c24-21(22-25)15-14-17-8-7-13-20(16-17)28(26,27)23(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1,3-5,7-16,25H,2,6H2,(H,22,24)/b15-14+ |
| InChIKey | AJEORVDPKFDQDZ-CCEZHUSRSA-N |
| XLogP | 3.63 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|