C18H15N3O5S — CID 166063359
[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-isoquinolin-7-ylsulfamic acid (PubChem CID 166063359) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is [3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-isoquinolin-7-ylsulfamic acid.
| Compound Name | [3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-isoquinolin-7-ylsulfamic acid |
|---|---|
| PubChem CID | 166063359 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-isoquinolin-7-ylsulfamic acid |
| SMILES | O=C(/C=C/c1cccc(N(c2ccc3ccncc3c2)S(=O)(=O)O)c1)NO |
| InChI | InChI=1S/C18H15N3O5S/c22-18(20-23)7-4-13-2-1-3-16(10-13)21(27(24,25)26)17-6-5-14-8-9-19-12-15(14)11-17/h1-12,23H,(H,20,22)(H,24,25,26)/b7-4+ |
| InChIKey | VIZCKXQEXSRLIE-QPJJXVBHSA-N |
| XLogP | 2.69 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|