C13H14N4O3 — CID 139377876
(E)-N-hydroxy-3-[3-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenyl]prop-2-enamide (PubChem CID 139377876) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[3-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[3-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139377876 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (E)-N-hydroxy-3-[3-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenyl]prop-2-enamide |
| SMILES | Cc1nnc(NCc2cccc(/C=C/C(=O)NO)c2)o1 |
| InChI | InChI=1S/C13H14N4O3/c1-9-15-16-13(20-9)14-8-11-4-2-3-10(7-11)5-6-12(18)17-19/h2-7,19H,8H2,1H3,(H,14,16)(H,17,18)/b6-5+ |
| InChIKey | VENGDUGFWSBFRI-AATRIKPKSA-N |
| XLogP | 1.51 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|