C16H20N2O5 — CID 173077180
4-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]oxane-4-carboxylic acid (PubChem CID 173077180) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]oxane-4-carboxylic acid.
| Compound Name | 4-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 173077180 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 4-[[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]oxane-4-carboxylic acid |
| SMILES | O=C(C=Cc1cccc(CNC2(C(=O)O)CCOCC2)c1)NO |
| InChI | InChI=1S/C16H20N2O5/c19-14(18-22)5-4-12-2-1-3-13(10-12)11-17-16(15(20)21)6-8-23-9-7-16/h1-5,10,17,22H,6-9,11H2,(H,18,19)(H,20,21) |
| InChIKey | SMCAGZALSQHWGG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|