C25H24N2O4 — CID 175574114
N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-naphthalen-2-yloxane-4-carboxamide (PubChem CID 175574114) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-naphthalen-2-yloxane-4-carboxamide.
| Compound Name | N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-naphthalen-2-yloxane-4-carboxamide |
|---|---|
| PubChem CID | 175574114 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-naphthalen-2-yloxane-4-carboxamide |
| SMILES | O=C(C=Cc1cccc(NC(=O)C2(c3ccc4ccccc4c3)CCOCC2)c1)NO |
| InChI | InChI=1S/C25H24N2O4/c28-23(27-30)11-8-18-4-3-7-22(16-18)26-24(29)25(12-14-31-15-13-25)21-10-9-19-5-1-2-6-20(19)17-21/h1-11,16-17,30H,12-15H2,(H,26,29)(H,27,28) |
| InChIKey | UMFHIJXFDOPBKQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|