C21H20N2O3 — CID 85330809
N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-methyl-5-phenylpenta-2,4-dienamide (PubChem CID 85330809) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-methyl-5-phenylpenta-2,4-dienamide.
| Compound Name | N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-methyl-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 85330809 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[3-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-methyl-5-phenylpenta-2,4-dienamide |
| SMILES | CC(C=CC(=O)Nc1cccc(C=CC(=O)NO)c1)=Cc1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c1-16(14-17-6-3-2-4-7-17)10-12-20(24)22-19-9-5-8-18(15-19)11-13-21(25)23-26/h2-15,26H,1H3,(H,22,24)(H,23,25) |
| InChIKey | DWLKURFLMUIMJS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|