C26H22N2O4 — CID 56508324
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-phenyloxane-4-carboxamide (PubChem CID 56508324) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 56508324 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-phenyloxane-4-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(NC(=O)C2(c3ccccc3)CCOCC2)c1 |
| InChI | InChI=1S/C26H22N2O4/c29-23-21-11-4-5-12-22(21)24(30)28(23)20-10-6-9-19(17-20)27-25(31)26(13-15-32-16-14-26)18-7-2-1-3-8-18/h1-12,17H,13-16H2,(H,27,31) |
| InChIKey | HUOIGNZVAXABTQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|