About N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 56508067) has the molecular formula C24H15N3O4
and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 56508067 |
| Molecular Formula | C24H15N3O4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C24H15N3O4/c28-22(21-14-20(26-31-21)15-7-2-1-3-8-15)25-16-9-6-10-17(13-16)27-23(29)18-11-4-5-12-19(18)24(27)30/h1-14H,(H,25,28) |
| InChIKey | QPJHGSDPVXJYCW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide (CID 56508067) is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide is O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1cc(-c2ccccc2)no1.
What is the InChIKey of N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide?
The InChIKey is QPJHGSDPVXJYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15N3O4/c28-22(21-14-20(26-31-21)15-7-2-1-3-8-15)25-16-9-6-10-17(13-16)27-23(29)18-11-4-5-12-19(18)24(27)30/h1-14H,(H,25,28).
What are the key properties of N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide?
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide has a molecular weight of 409.40 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 56508067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).