C24H15N3O4 — CID 56508067
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 56508067) has the molecular formula C24H15N3O4 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 56508067 |
| Molecular Formula | C24H15N3O4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C24H15N3O4/c28-22(21-14-20(26-31-21)15-7-2-1-3-8-15)25-16-9-6-10-17(13-16)27-23(29)18-11-4-5-12-19(18)24(27)30/h1-14H,(H,25,28) |
| InChIKey | QPJHGSDPVXJYCW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|