C16H13N3O2 — CID 89210653
N-(3-aminophenyl)-3-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 89210653) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(3-aminophenyl)-3-phenyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(3-aminophenyl)-3-phenyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 89210653 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(3-aminophenyl)-3-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | Nc1cccc(NC(=O)c2cc(-c3ccccc3)no2)c1 |
| InChI | InChI=1S/C16H13N3O2/c17-12-7-4-8-13(9-12)18-16(20)15-10-14(19-21-15)11-5-2-1-3-6-11/h1-10H,17H2,(H,18,20) |
| InChIKey | OENQTHBQQXIAIO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|