C17H15N3O4S — CID 60610490
3-phenyl-N-[3-(sulfamoylmethyl)phenyl]-1,2-oxazole-5-carboxamide (PubChem CID 60610490) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 3-phenyl-N-[3-(sulfamoylmethyl)phenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-phenyl-N-[3-(sulfamoylmethyl)phenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 60610490 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-phenyl-N-[3-(sulfamoylmethyl)phenyl]-1,2-oxazole-5-carboxamide |
| SMILES | NS(=O)(=O)Cc1cccc(NC(=O)c2cc(-c3ccccc3)no2)c1 |
| InChI | InChI=1S/C17H15N3O4S/c18-25(22,23)11-12-5-4-8-14(9-12)19-17(21)16-10-15(20-24-16)13-6-2-1-3-7-13/h1-10H,11H2,(H,19,21)(H2,18,22,23) |
| InChIKey | JYWCQTWRFVNJRP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |