C12H12N2O3S2 — CID 86865208
N-[3-(sulfamoylmethyl)phenyl]thiophene-2-carboxamide (PubChem CID 86865208) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[3-(sulfamoylmethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(sulfamoylmethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86865208 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | N-[3-(sulfamoylmethyl)phenyl]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)Cc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C12H12N2O3S2/c13-19(16,17)8-9-3-1-4-10(7-9)14-12(15)11-5-2-6-18-11/h1-7H,8H2,(H,14,15)(H2,13,16,17) |
| InChIKey | IVDSEZBPEMQFND-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |