C19H19N3O2S2 — CID 75463773
N-[3-[(dimethylamino)methyl]phenyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide (PubChem CID 75463773) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[3-[(dimethylamino)methyl]phenyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide.
| Compound Name | N-[3-[(dimethylamino)methyl]phenyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 75463773 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-[3-[(dimethylamino)methyl]phenyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
| SMILES | CN(C)Cc1cccc(NC(=O)c2ccsc2NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H19N3O2S2/c1-22(2)12-13-5-3-6-14(11-13)20-17(23)15-8-10-26-19(15)21-18(24)16-7-4-9-25-16/h3-11H,12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | DGCJLQAEBQWPJH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |