C18H12Cl2N2O2S — CID 2280085
N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]thiophene-2-carboxamide (PubChem CID 2280085) has the molecular formula C18H12Cl2N2O2S and a molecular weight of 391.28 g/mol. Its IUPAC name is N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2280085 |
| Molecular Formula | C18H12Cl2N2O2S |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | N-[3-[(2,4-dichlorobenzoyl)amino]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1)c1cccs1 |
| InChI | InChI=1S/C18H12Cl2N2O2S/c19-11-6-7-14(15(20)9-11)17(23)21-12-3-1-4-13(10-12)22-18(24)16-5-2-8-25-16/h1-10H,(H,21,23)(H,22,24) |
| InChIKey | SSVOVHCTNIDTQV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |