C25H17N3O3S — CID 56507438
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(4-methylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 56507438) has the molecular formula C25H17N3O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(4-methylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(4-methylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 56507438 |
| Molecular Formula | C25H17N3O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(4-methylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(=O)Nc3cccc(N4C(=O)c5ccccc5C4=O)c3)cs2)cc1 |
| InChI | InChI=1S/C25H17N3O3S/c1-15-9-11-16(12-10-15)23-27-21(14-32-23)22(29)26-17-5-4-6-18(13-17)28-24(30)19-7-2-3-8-20(19)25(28)31/h2-14H,1H3,(H,26,29) |
| InChIKey | PXIDDEPNQNSCFH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|