C20H15N3OS — CID 22830902
2-(4-methylphenyl)-N-quinolin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 22830902) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-quinolin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-methylphenyl)-N-quinolin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 22830902 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-(4-methylphenyl)-N-quinolin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(=O)Nc3cnc4ccccc4c3)cs2)cc1 |
| InChI | InChI=1S/C20H15N3OS/c1-13-6-8-14(9-7-13)20-23-18(12-25-20)19(24)22-16-10-15-4-2-3-5-17(15)21-11-16/h2-12H,1H3,(H,22,24) |
| InChIKey | HTFFEDNNODZKTI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |