C17H14N2O3S2 — CID 55415574
N-(3-methylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 55415574) has the molecular formula C17H14N2O3S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-methylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55415574 |
| Molecular Formula | C17H14N2O3S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2csc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C17H14N2O3S2/c1-24(21,22)14-9-5-8-13(10-14)18-16(20)15-11-23-17(19-15)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,20) |
| InChIKey | AYDUHFNQQIGXNM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |