C19H17N3O2S — CID 86867681
N-(3-carbamoylphenyl)-2-(2,4-dimethylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 86867681) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-(3-carbamoylphenyl)-2-(2,4-dimethylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-carbamoylphenyl)-2-(2,4-dimethylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86867681 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(3-carbamoylphenyl)-2-(2,4-dimethylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(=O)Nc3cccc(C(N)=O)c3)cs2)c(C)c1 |
| InChI | InChI=1S/C19H17N3O2S/c1-11-6-7-15(12(2)8-11)19-22-16(10-25-19)18(24)21-14-5-3-4-13(9-14)17(20)23/h3-10H,1-2H3,(H2,20,23)(H,21,24) |
| InChIKey | DURWNHVOEHRRJU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |