C23H23NO4 — CID 157379960
(2S)-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]-3-(3H-inden-1-yl)propanoic acid (PubChem CID 157379960) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S)-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]-3-(3H-inden-1-yl)propanoic acid.
| Compound Name | (2S)-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]-3-(3H-inden-1-yl)propanoic acid |
|---|---|
| PubChem CID | 157379960 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]-3-(3H-inden-1-yl)propanoic acid |
| SMILES | O=C(/C=C/c1ccc(CN[C@@H](CC2=CCc3ccccc32)C(=O)O)cc1)CO |
| InChI | InChI=1S/C23H23NO4/c25-15-20(26)12-9-16-5-7-17(8-6-16)14-24-22(23(27)28)13-19-11-10-18-3-1-2-4-21(18)19/h1-9,11-12,22,24-25H,10,13-15H2,(H,27,28)/b12-9+/t22-/m0/s1 |
| InChIKey | WSIWLVQWZMDSAZ-FQTAANOTSA-N |
| XLogP | 2.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|