C26H29NO3 — CID 162200362
N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]-2-methylpropanamide (PubChem CID 162200362) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]-2-methylpropanamide.
| Compound Name | N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 162200362 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N(CCC1=CCc2ccccc21)Cc1ccc(/C=C/C(=O)CO)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-19(2)26(30)27(16-15-23-13-12-22-5-3-4-6-25(22)23)17-21-9-7-20(8-10-21)11-14-24(29)18-28/h3-11,13-14,19,28H,12,15-18H2,1-2H3/b14-11+ |
| InChIKey | ZRMPSMDTPNUXQJ-SDNWHVSQSA-N |
| XLogP | 4.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|