C26H31NO2 — CID 159658930
(E)-1-hydroxy-4-[4-[[[3-methyl-2-(5-methyl-3H-inden-1-yl)butyl]amino]methyl]phenyl]but-3-en-2-one (PubChem CID 159658930) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (E)-1-hydroxy-4-[4-[[[3-methyl-2-(5-methyl-3H-inden-1-yl)butyl]amino]methyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-1-hydroxy-4-[4-[[[3-methyl-2-(5-methyl-3H-inden-1-yl)butyl]amino]methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159658930 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (E)-1-hydroxy-4-[4-[[[3-methyl-2-(5-methyl-3H-inden-1-yl)butyl]amino]methyl]phenyl]but-3-en-2-one |
| SMILES | Cc1ccc2c(c1)CC=C2C(CNCc1ccc(/C=C/C(=O)CO)cc1)C(C)C |
| InChI | InChI=1S/C26H31NO2/c1-18(2)26(25-13-10-22-14-19(3)4-12-24(22)25)16-27-15-21-7-5-20(6-8-21)9-11-23(29)17-28/h4-9,11-14,18,26-28H,10,15-17H2,1-3H3/b11-9+ |
| InChIKey | MSNQOFMNNLGWKQ-PKNBQFBNSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|