C11H13NO2 — CID 146750094
(Z)-3-[4-(methylaminomethyl)phenyl]prop-2-enoic acid (PubChem CID 146750094) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (Z)-3-[4-(methylaminomethyl)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(methylaminomethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146750094 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (Z)-3-[4-(methylaminomethyl)phenyl]prop-2-enoic acid |
| SMILES | CNCc1ccc(/C=C\C(=O)O)cc1 |
| InChI | InChI=1S/C11H13NO2/c1-12-8-10-4-2-9(3-5-10)6-7-11(13)14/h2-7,12H,8H2,1H3,(H,13,14)/b7-6- |
| InChIKey | RNAWCXUEWRXQNF-SREVYHEPSA-N |
| XLogP | 1.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|