C12H16N2O — CID 164990335
(E)-N-methyl-3-[4-(methylaminomethyl)phenyl]prop-2-enamide (PubChem CID 164990335) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (E)-N-methyl-3-[4-(methylaminomethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-[4-(methylaminomethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 164990335 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (E)-N-methyl-3-[4-(methylaminomethyl)phenyl]prop-2-enamide |
| SMILES | CNCc1ccc(/C=C/C(=O)NC)cc1 |
| InChI | InChI=1S/C12H16N2O/c1-13-9-11-5-3-10(4-6-11)7-8-12(15)14-2/h3-8,13H,9H2,1-2H3,(H,14,15)/b8-7+ |
| InChIKey | UZEDHOQSVYBYLT-BQYQJAHWSA-N |
| XLogP | 1.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|