C14H17NO4S — CID 77052504
3-[4-[(cyclopropylmethylsulfonylamino)methyl]phenyl]prop-2-enoic acid (PubChem CID 77052504) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-[4-[(cyclopropylmethylsulfonylamino)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(cyclopropylmethylsulfonylamino)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77052504 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-[4-[(cyclopropylmethylsulfonylamino)methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CNS(=O)(=O)CC2CC2)cc1 |
| InChI | InChI=1S/C14H17NO4S/c16-14(17)8-7-11-1-3-12(4-2-11)9-15-20(18,19)10-13-5-6-13/h1-4,7-8,13,15H,5-6,9-10H2,(H,16,17) |
| InChIKey | RTBCEPVSJOZUEA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|