C13H14FNO4S — CID 77052484
3-[4-(cyclopropylmethylsulfonylamino)-3-fluorophenyl]prop-2-enoic acid (PubChem CID 77052484) has the molecular formula C13H14FNO4S and a molecular weight of 299.32 g/mol. Its IUPAC name is 3-[4-(cyclopropylmethylsulfonylamino)-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(cyclopropylmethylsulfonylamino)-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77052484 |
| Molecular Formula | C13H14FNO4S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-[4-(cyclopropylmethylsulfonylamino)-3-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(NS(=O)(=O)CC2CC2)c(F)c1 |
| InChI | InChI=1S/C13H14FNO4S/c14-11-7-9(4-6-13(16)17)3-5-12(11)15-20(18,19)8-10-1-2-10/h3-7,10,15H,1-2,8H2,(H,16,17) |
| InChIKey | WZLZPRBQTGXNPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|