C17H21FO3 — CID 107692338
(E)-3-[4-(4-ethylcyclohexyl)oxy-3-fluorophenyl]prop-2-enoic acid (PubChem CID 107692338) has the molecular formula C17H21FO3 and a molecular weight of 292.35 g/mol. Its IUPAC name is (E)-3-[4-(4-ethylcyclohexyl)oxy-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(4-ethylcyclohexyl)oxy-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107692338 |
| Molecular Formula | C17H21FO3 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (E)-3-[4-(4-ethylcyclohexyl)oxy-3-fluorophenyl]prop-2-enoic acid |
| SMILES | CCC1CCC(Oc2ccc(/C=C/C(=O)O)cc2F)CC1 |
| InChI | InChI=1S/C17H21FO3/c1-2-12-3-7-14(8-4-12)21-16-9-5-13(11-15(16)18)6-10-17(19)20/h5-6,9-12,14H,2-4,7-8H2,1H3,(H,19,20)/b10-6+ |
| InChIKey | JCLSSYONBXUBAI-UXBLZVDNSA-N |
| XLogP | 4.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|