C16H20O5 — CID 107135194
(E)-3-[3-ethoxy-4-(oxan-3-yloxy)phenyl]prop-2-enoic acid (PubChem CID 107135194) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-(oxan-3-yloxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-ethoxy-4-(oxan-3-yloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107135194 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (E)-3-[3-ethoxy-4-(oxan-3-yloxy)phenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C/C(=O)O)ccc1OC1CCCOC1 |
| InChI | InChI=1S/C16H20O5/c1-2-20-15-10-12(6-8-16(17)18)5-7-14(15)21-13-4-3-9-19-11-13/h5-8,10,13H,2-4,9,11H2,1H3,(H,17,18)/b8-6+ |
| InChIKey | ATOLONAUUZBHFE-SOFGYWHQSA-N |
| XLogP | 2.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|