C14H16O5 — CID 95355313
(E)-3-[3-methoxy-4-[(3S)-oxolan-3-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 95355313) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-[(3S)-oxolan-3-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methoxy-4-[(3S)-oxolan-3-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 95355313 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (E)-3-[3-methoxy-4-[(3S)-oxolan-3-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C14H16O5/c1-17-13-8-10(3-5-14(15)16)2-4-12(13)19-11-6-7-18-9-11/h2-5,8,11H,6-7,9H2,1H3,(H,15,16)/b5-3+/t11-/m0/s1 |
| InChIKey | OYKKLCJIPMLLEF-TZNOJPMFSA-N |
| XLogP | 1.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|