C15H18O4 — CID 76999106
3-[3,5-dimethyl-4-(oxolan-3-yloxy)phenyl]prop-2-enoic acid (PubChem CID 76999106) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-(oxolan-3-yloxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-dimethyl-4-(oxolan-3-yloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76999106 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-[3,5-dimethyl-4-(oxolan-3-yloxy)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)cc(C)c1OC1CCOC1 |
| InChI | InChI=1S/C15H18O4/c1-10-7-12(3-4-14(16)17)8-11(2)15(10)19-13-5-6-18-9-13/h3-4,7-8,13H,5-6,9H2,1-2H3,(H,16,17) |
| InChIKey | YVUGWBDFOAVINK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|