C14H15BrO4 — CID 107135193
(E)-3-[5-bromo-2-(oxan-3-yloxy)phenyl]prop-2-enoic acid (PubChem CID 107135193) has the molecular formula C14H15BrO4 and a molecular weight of 327.17 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-(oxan-3-yloxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-bromo-2-(oxan-3-yloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107135193 |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | (E)-3-[5-bromo-2-(oxan-3-yloxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(Br)ccc1OC1CCCOC1 |
| InChI | InChI=1S/C14H15BrO4/c15-11-4-5-13(10(8-11)3-6-14(16)17)19-12-2-1-7-18-9-12/h3-6,8,12H,1-2,7,9H2,(H,16,17)/b6-3+ |
| InChIKey | PDKNNVUXYAEHEO-ZZXKWVIFSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|