C14H19NO4S — CID 81291331
(E)-3-[3-ethyl-4-(propylsulfonylamino)phenyl]prop-2-enoic acid (PubChem CID 81291331) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (E)-3-[3-ethyl-4-(propylsulfonylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-ethyl-4-(propylsulfonylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81291331 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (E)-3-[3-ethyl-4-(propylsulfonylamino)phenyl]prop-2-enoic acid |
| SMILES | CCCS(=O)(=O)Nc1ccc(/C=C/C(=O)O)cc1CC |
| InChI | InChI=1S/C14H19NO4S/c1-3-9-20(18,19)15-13-7-5-11(6-8-14(16)17)10-12(13)4-2/h5-8,10,15H,3-4,9H2,1-2H3,(H,16,17)/b8-6+ |
| InChIKey | HHTQSRVIKZWNJP-SOFGYWHQSA-N |
| XLogP | 2.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|