C14H14F3NO3 — CID 81288227
(E)-3-[3-ethyl-4-(3,3,3-trifluoropropanoylamino)phenyl]prop-2-enoic acid (PubChem CID 81288227) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is (E)-3-[3-ethyl-4-(3,3,3-trifluoropropanoylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-ethyl-4-(3,3,3-trifluoropropanoylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81288227 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (E)-3-[3-ethyl-4-(3,3,3-trifluoropropanoylamino)phenyl]prop-2-enoic acid |
| SMILES | CCc1cc(/C=C/C(=O)O)ccc1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C14H14F3NO3/c1-2-10-7-9(4-6-13(20)21)3-5-11(10)18-12(19)8-14(15,16)17/h3-7H,2,8H2,1H3,(H,18,19)(H,20,21)/b6-4+ |
| InChIKey | DRAITMCTCXQZIP-GQCTYLIASA-N |
| XLogP | 3.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|