C14H19NO5S — CID 76994207
3-[4-(3-methoxypropylsulfonylamino)-3-methylphenyl]prop-2-enoic acid (PubChem CID 76994207) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-[4-(3-methoxypropylsulfonylamino)-3-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(3-methoxypropylsulfonylamino)-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76994207 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-[4-(3-methoxypropylsulfonylamino)-3-methylphenyl]prop-2-enoic acid |
| SMILES | COCCCS(=O)(=O)Nc1ccc(C=CC(=O)O)cc1C |
| InChI | InChI=1S/C14H19NO5S/c1-11-10-12(5-7-14(16)17)4-6-13(11)15-21(18,19)9-3-8-20-2/h4-7,10,15H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | PYJRYBRCSXGIFE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|