C13H18N2O5S — CID 114816706
(E)-3-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]prop-2-enoic acid (PubChem CID 114816706) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is (E)-3-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114816706 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (E)-3-[4-(2-methoxyethylsulfamoylamino)-3-methylphenyl]prop-2-enoic acid |
| SMILES | COCCNS(=O)(=O)Nc1ccc(/C=C/C(=O)O)cc1C |
| InChI | InChI=1S/C13H18N2O5S/c1-10-9-11(4-6-13(16)17)3-5-12(10)15-21(18,19)14-7-8-20-2/h3-6,9,14-15H,7-8H2,1-2H3,(H,16,17)/b6-4+ |
| InChIKey | KACHQRPAARCJQA-GQCTYLIASA-N |
| XLogP | 0.99 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|